EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CCSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | GGLZPLKKBSSKCX-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-ethionine (CHEBI:4886) has role antimetabolite (CHEBI:35221) |
| L-ethionine (CHEBI:4886) has role carcinogenic agent (CHEBI:50903) |
| L-ethionine (CHEBI:4886) is a S-ethylhomocysteine (CHEBI:68662) |
| L-ethionine (CHEBI:4886) is enantiomer of D-ethionine (CHEBI:68663) |
| Incoming Relation(s) |
| DL-ethionine (CHEBI:68664) has part L-ethionine (CHEBI:4886) |
| D-ethionine (CHEBI:68663) is enantiomer of L-ethionine (CHEBI:4886) |
| IUPAC Name |
|---|
| S-ethyl-L-homocysteine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-4-(ethylsulfanyl)butanoic acid | IUPAC |
| (+)-S-ethyl-L-homocysteine | ChEBI |
| (+)-ethionine | ChEBI |
| Ethionine | KEGG COMPOUND |
| L-2-amino-4-(ethylthio)butanoic acid | ChEBI |
| L-2-amino-4-(ethylthio)butyric acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722528 | Reaxys |
| CAS:13073-35-3 | KEGG COMPOUND |
| CAS:13073-35-3 | ChemIDplus |
| Citations |
|---|