EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | CC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7,12H,2-3H2,1H3 |
| InChIKey | NJGBTKGETPDVIK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. hepatoprotective agent Any compound that is able to prevent damage to the liver. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raspberry ketone (CHEBI:68656) has role androgen antagonist (CHEBI:35497) |
| raspberry ketone (CHEBI:68656) has role cosmetic (CHEBI:64857) |
| raspberry ketone (CHEBI:68656) has role flavouring agent (CHEBI:35617) |
| raspberry ketone (CHEBI:68656) has role fragrance (CHEBI:48318) |
| raspberry ketone (CHEBI:68656) has role hepatoprotective agent (CHEBI:62868) |
| raspberry ketone (CHEBI:68656) has role metabolite (CHEBI:25212) |
| raspberry ketone (CHEBI:68656) is a methyl ketone (CHEBI:51867) |
| raspberry ketone (CHEBI:68656) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(4-hydroxyphenyl)butan-2-one |
| Synonyms | Source |
|---|---|
| 1-(4-Hydroxyphenyl)-3-butanone | ChemIDplus |
| 1-(p-Hydroxyphenyl)-3-butanone | ChemIDplus |
| 4-(3-Oxobutyl)phenol | ChemIDplus |
| 4-(4-Hydroxyphenyl)-2-butanone | ChemIDplus |
| 4-Hydroxybenzylacetone | NIST Chemistry WebBook |
| 4-(p-Hydroxyphenyl)-2-butanone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-8647 | MetaCyc |
| GB2470338 | Patent |
| HMDB0033723 | HMDB |
| Raspberry_ketone | Wikipedia |
| US2009221694 | Patent |
| US2011257439 | Patent |
| US2012052137 | Patent |
| US6222062 | Patent |
| WO2008113495 | Patent |
| WO2009118755 | Patent |
| WO2012085287 | Patent |
| Citations |
|---|