EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68656 - raspberry ketone
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | CC(=O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H12O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7,12H,2-3H2,1H3 |
| InChIKey | NJGBTKGETPDVIK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raspberry ketone (CHEBI:68656) has role androgen antagonist (CHEBI:35497) |
| raspberry ketone (CHEBI:68656) has role cosmetic (CHEBI:64857) |
| raspberry ketone (CHEBI:68656) has role flavouring agent (CHEBI:35617) |
| raspberry ketone (CHEBI:68656) has role fragrance (CHEBI:48318) |
| raspberry ketone (CHEBI:68656) has role hepatoprotective agent (CHEBI:62868) |
| raspberry ketone (CHEBI:68656) has role metabolite (CHEBI:25212) |
| raspberry ketone (CHEBI:68656) is a methyl ketone (CHEBI:51867) |
| raspberry ketone (CHEBI:68656) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(4-hydroxyphenyl)butan-2-one |
| Synonyms | Source |
|---|---|
| 1-(4-Hydroxyphenyl)-3-butanone | ChemIDplus |
| 1-(p-Hydroxyphenyl)-3-butanone | ChemIDplus |
| 4-(3-Oxobutyl)phenol | ChemIDplus |
| 4-(4-Hydroxyphenyl)-2-butanone | ChemIDplus |
| 4-Hydroxybenzylacetone | NIST Chemistry WebBook |
| 4-(p-Hydroxyphenyl)-2-butanone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-8647 | MetaCyc |
| GB2470338 | Patent |
| HMDB0033723 | HMDB |
| Raspberry_ketone | Wikipedia |
| US2009221694 | Patent |
| US2011257439 | Patent |
| US2012052137 | Patent |
| US6222062 | Patent |
| WO2008113495 | Patent |
| WO2009118755 | Patent |
| WO2012085287 | Patent |
| Citations |
|---|