EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30Cl2NO6P |
| Net Charge | -2 |
| Average Mass | 518.374 |
| Monoisotopic Mass | 517.11988 |
| SMILES | [H][C@@]12CCc3cc(OC(=O)N(CCCl)CCCl)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](OP(=O)([O-])[O-])CC[C@@]21[H] |
| InChI | InChI=1S/C23H32Cl2NO6P/c1-23-9-8-18-17-5-3-16(31-22(27)26(12-10-24)13-11-25)14-15(17)2-4-19(18)20(23)6-7-21(23)32-33(28,29)30/h3,5,14,18-21H,2,4,6-13H2,1H3,(H2,28,29,30)/p-2/t18-,19-,20+,21+,23+/m1/s1 |
| InChIKey | ADFOJJHRTBFFOF-RBRWEJTLSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estramustine phosphate(2−) (CHEBI:68644) is a steroid phosphate oxoanion (CHEBI:68607) |
| estramustine phosphate(2−) (CHEBI:68644) is conjugate base of estramustine phosphate (CHEBI:68643) |
| Incoming Relation(s) |
| estramustine sodium phosphate (CHEBI:31562) has part estramustine phosphate(2−) (CHEBI:68644) |
| estramustine phosphate (CHEBI:68643) is conjugate acid of estramustine phosphate(2−) (CHEBI:68644) |
| IUPAC Name |
|---|
| (17β)-3-{[bis(2-chloroethyl)carbamoyl]oxy}estra-1(10),2,4-trien-17-yl phosphate |