EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30Cl2NO6P.2Na |
| Net Charge | 0 |
| Average Mass | 564.354 |
| Monoisotopic Mass | 563.09832 |
| SMILES | [H][C@@]12CCc3cc(OC(=O)N(CCCl)CCCl)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](OP(=O)([O-])[O-])CC[C@@]21[H].[Na+].[Na+] |
| InChI | InChI=1S/C23H32Cl2NO6P.2Na/c1-23-9-8-18-17-5-3-16(31-22(27)26(12-10-24)13-11-25)14-15(17)2-4-19(18)20(23)6-7-21(23)32-33(28,29)30;;/h3,5,14,18-21H,2,4,6-13H2,1H3,(H2,28,29,30);;/q;2*+1/p-2/t18-,19-,20+,21+,23+;;/m1../s1 |
| InChIKey | IIUMCNJTGSMNRO-VVSKJQCTSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estramustine sodium phosphate (CHEBI:31562) has part estramustine phosphate(2−) (CHEBI:68644) |
| estramustine sodium phosphate (CHEBI:31562) has role antineoplastic agent (CHEBI:35610) |
| estramustine sodium phosphate (CHEBI:31562) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (17β)-3-{[bis(2-chloroethyl)carbamoyl]oxy}estra-1(10),2,4-trien-17-yl phosphate |
| Synonyms | Source |
|---|---|
| Estradiol 3-(bis(2-chloroethyl)carbamate) 17-(dihydrogen phosphate), disodium salt | ChemIDplus |
| Estramustine 17-(dihydrogenphosphate) disodium salt anhydrous | ChEMBL |
| Estramustine 17-(dihydrogenphosphate) disodium salt monohydrate | ChEMBL |
| Estramustine phosphate disodium | ChemIDplus |
| estramustine phosphate sodium | ChEMBL |
| Estramustine phosphate sodium hydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Emcyt | DrugBank |
| Estracyt | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:52205-73-9 | ChemIDplus |
| Citations |
|---|