EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31NO |
| Net Charge | 0 |
| Average Mass | 349.518 |
| Monoisotopic Mass | 349.24056 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(c3cccnc3)=CC[C@@]21[H] |
| InChI | InChI=1S/C24H31NO/c1-23-11-9-18(26)14-17(23)5-6-19-21-8-7-20(16-4-3-13-25-15-16)24(21,2)12-10-22(19)23/h3-5,7,13,15,18-19,21-22,26H,6,8-12,14H2,1-2H3/t18-,19-,21-,22-,23-,24+/m0/s1 |
| InChIKey | GZOSMCIZMLWJML-VJLLXTKPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.9 (steroid 17alpha-monooxygenase) inhibitor An EC 1.14.99.* (miscellaneous oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the action of cytochrome P450 17-α-hydroxylase/C17,20-lyase (EC 1.14.99.9). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abiraterone (CHEBI:68642) has parent hydride androstane (CHEBI:35509) |
| abiraterone (CHEBI:68642) has role antineoplastic agent (CHEBI:35610) |
| abiraterone (CHEBI:68642) has role EC 1.14.99.9 (steroid 17α-monooxygenase) inhibitor (CHEBI:68640) |
| abiraterone (CHEBI:68642) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| abiraterone (CHEBI:68642) is a 3β-sterol (CHEBI:35348) |
| abiraterone (CHEBI:68642) is a pyridines (CHEBI:26421) |
| Incoming Relation(s) |
| abiraterone acetate (CHEBI:68639) has functional parent abiraterone (CHEBI:68642) |
| IUPAC Name |
|---|
| 17-(pyridin-3-yl)androsta-5,16-dien-3β-ol |
| INN | Source |
|---|---|
| abiraterone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-(3-Pyridyl)androsta-5,16-dien-3beta-ol | ChemIDplus |
| (3β)-17-(pyridin-3-yl)androsta-5,16-dien-3-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Abiraterone | Wikipedia |
| AER | PDBeChem |
| EP1336602 | Patent |
| US2011034428 | Patent |
| US5604213 | Patent |
| WO2012083112 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7309269 | Reaxys |
| CAS:154229-19-3 | ChemIDplus |
| Citations |
|---|