EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO2 |
| Net Charge | 0 |
| Average Mass | 391.555 |
| Monoisotopic Mass | 391.25113 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OC(C)=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(c3cccnc3)=CC[C@@]21[H] |
| InChI | InChI=1S/C26H33NO2/c1-17(28)29-20-10-12-25(2)19(15-20)6-7-21-23-9-8-22(18-5-4-14-27-16-18)26(23,3)13-11-24(21)25/h4-6,8,14,16,20-21,23-24H,7,9-13,15H2,1-3H3/t20-,21-,23-,24-,25-,26+/m0/s1 |
| InChIKey | UVIQSJCZCSLXRZ-UBUQANBQSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.9 (steroid 17alpha-monooxygenase) inhibitor An EC 1.14.99.* (miscellaneous oxidoreductase acting on paired donors, with incorporation or reduction of molecular oxygen) inhibitor that interferes with the action of cytochrome P450 17-α-hydroxylase/C17,20-lyase (EC 1.14.99.9). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abiraterone acetate (CHEBI:68639) has functional parent abiraterone (CHEBI:68642) |
| abiraterone acetate (CHEBI:68639) has role antineoplastic agent (CHEBI:35610) |
| abiraterone acetate (CHEBI:68639) has role EC 1.14.99.9 (steroid 17α-monooxygenase) inhibitor (CHEBI:68640) |
| abiraterone acetate (CHEBI:68639) has role prodrug (CHEBI:50266) |
| abiraterone acetate (CHEBI:68639) is a pyridines (CHEBI:26421) |
| abiraterone acetate (CHEBI:68639) is a sterol ester (CHEBI:35915) |
| IUPAC Name |
|---|
| 17-(pyridin-3-yl)androsta-5,16-dien-3β-yl acetate |
| Synonyms | Source |
|---|---|
| 17-(3-Pyridyl)-5,16-androstadien-3beta-acetate | ChemIDplus |
| (3β)-17-(pyridin-3-yl)androsta-5,16-dien-3-yl acetate | IUPAC |
| Brand Name | Source |
|---|---|
| Zytiga | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09701 | KEGG DRUG |
| WO2012083112 | Patent |
| WO2006021776 | Patent |
| US2011201563 | Patent |
| US2008051380 | Patent |
| 4176 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7314563 | Reaxys |
| CAS:154229-18-2 | KEGG DRUG |
| CAS:154229-18-2 | ChemIDplus |
| Citations |
|---|