EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18ClN3O2 |
| Net Charge | 0 |
| Average Mass | 247.726 |
| Monoisotopic Mass | 247.10875 |
| SMILES | CC1CCC(NC(=O)N(CCCl)N=O)CC1 |
| InChI | InChI=1S/C10H18ClN3O2/c1-8-2-4-9(5-3-8)12-10(15)14(13-16)7-6-11/h8-9H,2-7H2,1H3,(H,12,15) |
| InChIKey | FVLVBPDQNARYJU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| semustine (CHEBI:6863) has role alkylating agent (CHEBI:22333) |
| semustine (CHEBI:6863) has role antineoplastic agent (CHEBI:35610) |
| semustine (CHEBI:6863) has role carcinogenic agent (CHEBI:50903) |
| semustine (CHEBI:6863) is a N-nitrosoureas (CHEBI:76551) |
| semustine (CHEBI:6863) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 1-(2-chloroethyl)-3-(4-methylcyclohexyl)-1-nitrosourea |
| INNs | Source |
|---|---|
| semustina | ChemIDplus |
| semustine | KEGG DRUG |
| sémustine | WHO MedNet |
| semustinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Chloroethyl)-1-([(4-methylcyclohexyl)amino]carbonyl)-2-oxohydrazine | NIST Chemistry WebBook |
| 1-(2-Chloroethyl)-3-(4-methylcyclohexyl)-1-nitrosourea | KEGG COMPOUND |
| ICIG 1110 | ChEMBL |
| ICIG-1110 | ChEMBL |
| Methyl-CCNU | KEGG COMPOUND |
| N-(2-Chloroethyl)-N'-(4-methylcyclohexyl)-N-nitrosourea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2738961 | Reaxys |
| CAS:13909-09-6 | KEGG COMPOUND |
| CAS:13909-09-6 | NIST Chemistry WebBook |
| CAS:13909-09-6 | ChemIDplus |
| Citations |
|---|