EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N2O3 |
| Net Charge | 0 |
| Average Mass | 392.499 |
| Monoisotopic Mass | 392.20999 |
| SMILES | CCc1cc2c(cc1CC)CC(NC[C@H](O)c1ccc(O)c3nc(=O)ccc13)C2 |
| InChI | InChI=1S/C24H28N2O3/c1-3-14-9-16-11-18(12-17(16)10-15(14)4-2)25-13-22(28)19-5-7-21(27)24-20(19)6-8-23(29)26-24/h5-10,18,22,25,27-28H,3-4,11-13H2,1-2H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | QZZUEBNBZAPZLX-QFIPXVFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indacaterol (CHEBI:68575) has role bronchodilator agent (CHEBI:35523) |
| indacaterol (CHEBI:68575) has role β-adrenergic agonist (CHEBI:35522) |
| indacaterol (CHEBI:68575) is a indanes (CHEBI:46940) |
| indacaterol (CHEBI:68575) is a monohydroxyquinoline (CHEBI:38775) |
| indacaterol (CHEBI:68575) is a quinolone (CHEBI:23765) |
| indacaterol (CHEBI:68575) is a secondary alcohol (CHEBI:35681) |
| indacaterol (CHEBI:68575) is a secondary amino compound (CHEBI:50995) |
| indacaterol (CHEBI:68575) is conjugate base of indacaterol(1+) (CHEBI:68574) |
| Incoming Relation(s) |
| indacaterol(1+) (CHEBI:68574) is conjugate acid of indacaterol (CHEBI:68575) |
| IUPAC Name |
|---|
| 5-{(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl}-8-hydroxyquinolin-2(1H)-one |
| INN | Source |
|---|---|
| indacaterol | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 5-(2-(5,6-Diethylindan-2-ylamino)-1-hydroxyethyl)-8-hydroxy-1H-quinolin-2-one | ChemIDplus |
| QAB 149 | ChemIDplus |
| QAB-149 | ChemIDplus |
| QAB149 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4183 | DrugCentral |
| D09318 | KEGG DRUG |
| DB05039 | DrugBank |
| HMDB0015608 | HMDB |
| Indacaterol | Wikipedia |
| WO2005123684 | Patent |
| WO2006128675 | Patent |
| WO2010114472 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10392427 | Reaxys |
| CAS:312753-06-3 | KEGG DRUG |
| CAS:312753-06-3 | ChemIDplus |
| Citations |
|---|