EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N2O3 |
| Net Charge | +1 |
| Average Mass | 393.507 |
| Monoisotopic Mass | 393.21727 |
| SMILES | CCc1cc2c(cc1CC)CC([NH2+]C[C@H](O)c1ccc(O)c3nc(=O)ccc13)C2 |
| InChI | InChI=1S/C24H28N2O3/c1-3-14-9-16-11-18(12-17(16)10-15(14)4-2)25-13-22(28)19-5-7-21(27)24-20(19)6-8-23(29)26-24/h5-10,18,22,25,27-28H,3-4,11-13H2,1-2H3,(H,26,29)/p+1/t22-/m0/s1 |
| InChIKey | QZZUEBNBZAPZLX-QFIPXVFZSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indacaterol(1+) (CHEBI:68574) is a ammonium ion derivative (CHEBI:35274) |
| indacaterol(1+) (CHEBI:68574) is a organic cation (CHEBI:25697) |
| indacaterol(1+) (CHEBI:68574) is conjugate acid of indacaterol (CHEBI:68575) |
| Incoming Relation(s) |
| indacaterol maleate (CHEBI:68573) has part indacaterol(1+) (CHEBI:68574) |
| indacaterol (CHEBI:68575) is conjugate base of indacaterol(1+) (CHEBI:68574) |
| IUPAC Name |
|---|
| 5,6-diethyl-N-[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1,2-dihydroquinolin-5-yl)ethyl]indan-2-aminium |
| Synonym | Source |
|---|---|
| indacaterol cation | ChEBI |