EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | O7P2 |
| Net Charge | -3 |
| Average Mass | 173.941 |
| Monoisotopic Mass | 173.91357 |
| SMILES | *OP(=O)([O-])OP(=O)([O-])[O-] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphosphate group(3−) (CHEBI:68549) is a inorganic anionic group (CHEBI:64776) |
| diphosphate group(3−) (CHEBI:68549) is conjugate base of diphosphate group (CHEBI:68836) |
| diphosphate group(3−) (CHEBI:68549) is substituent group from diphosphate(3−) (CHEBI:33019) |
| Incoming Relation(s) |
| diphosphate group (CHEBI:68836) is conjugate acid of diphosphate group(3−) (CHEBI:68549) |
| IUPAC Name |
|---|
| [(phosphonatooxy)phosphinato]oxy |
| Synonym | Source |
|---|---|
| diphosphonatooxy group(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| diphosphate group | UniProt |