EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HO7P2 |
| Net Charge | -3 |
| Average Mass | 174.949 |
| Monoisotopic Mass | 174.92140 |
| SMILES | O=P([O-])([O-])OP(=O)([O-])O |
| InChI | InChI=1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-3 |
| InChIKey | XPPKVPWEQAFLFU-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphosphate(3−) (CHEBI:33019) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| diphosphate(3−) (CHEBI:33019) has role human metabolite (CHEBI:77746) |
| diphosphate(3−) (CHEBI:33019) is a diphosphate ion (CHEBI:35782) |
| diphosphate(3−) (CHEBI:33019) is a trivalent inorganic anion (CHEBI:79387) |
| diphosphate(3−) (CHEBI:33019) is conjugate acid of diphosphate(4−) (CHEBI:18361) |
| diphosphate(3−) (CHEBI:33019) is conjugate base of diphosphate(2−) (CHEBI:45212) |
| Incoming Relation(s) |
| diphosphate(2−) (CHEBI:45212) is conjugate acid of diphosphate(3−) (CHEBI:33019) |
| diphosphate(4−) (CHEBI:18361) is conjugate base of diphosphate(3−) (CHEBI:33019) |
| diphosphate group(3−) (CHEBI:68549) is substituent group from diphosphate(3−) (CHEBI:33019) |
| IUPAC Name |
|---|
| hydrogen diphosphate |
| Synonym | Source |
|---|---|
| HP2O73− | IUPAC |
| UniProt Name | Source |
|---|---|
| diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:185088 | Beilstein |