EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14F4N4O2S |
| Net Charge | 0 |
| Average Mass | 450.417 |
| Monoisotopic Mass | 450.07736 |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1c1ccc(C(N)=O)c(F)c1 |
| InChI | InChI=1S/C20H14F4N4O2S/c1-19(2)17(30)27(11-4-3-10(9-25)14(7-11)20(22,23)24)18(31)28(19)12-5-6-13(16(26)29)15(21)8-12/h3-8H,1-2H3,(H2,26,29) |
| InChIKey | JSFOGZGIBIQRPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-desmethylenzalutamide (CHEBI:68538) has role androgen antagonist (CHEBI:35497) |
| N-desmethylenzalutamide (CHEBI:68538) has role antineoplastic agent (CHEBI:35610) |
| N-desmethylenzalutamide (CHEBI:68538) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| N-desmethylenzalutamide (CHEBI:68538) is a benzamides (CHEBI:22702) |
| N-desmethylenzalutamide (CHEBI:68538) is a imidazolidinone (CHEBI:55370) |
| N-desmethylenzalutamide (CHEBI:68538) is a monofluorobenzenes (CHEBI:83575) |
| N-desmethylenzalutamide (CHEBI:68538) is a nitrile (CHEBI:18379) |
| N-desmethylenzalutamide (CHEBI:68538) is a thiocarbonyl compound (CHEBI:50492) |
| IUPAC Name |
|---|
| 4-{3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl}-2-fluorobenzamide |
| Synonym | Source |
|---|---|
| N-desmethyl enzalutamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20830878 | Reaxys |