EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:68534 - enzalutamide
| Formula | C21H16F4N4O2S |
| Net Charge | 0 |
| Average Mass | 464.444 |
| Monoisotopic Mass | 464.09301 |
| SMILES | CNC(=O)c1ccc(N2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)cc1F |
| InChI | InChI=1S/C21H16F4N4O2S/c1-20(2)18(31)28(12-5-4-11(10-26)15(8-12)21(23,24)25)19(32)29(20)13-6-7-14(16(22)9-13)17(30)27-3/h4-9H,1-3H3,(H,27,30) |
| InChIKey | WXCXUHSOUPDCQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Applications: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enzalutamide (CHEBI:68534) has role androgen antagonist (CHEBI:35497) |
| enzalutamide (CHEBI:68534) has role antineoplastic agent (CHEBI:35610) |
| enzalutamide (CHEBI:68534) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| enzalutamide (CHEBI:68534) is a benzamides (CHEBI:22702) |
| enzalutamide (CHEBI:68534) is a imidazolidinone (CHEBI:55370) |
| enzalutamide (CHEBI:68534) is a monofluorobenzenes (CHEBI:83575) |
| enzalutamide (CHEBI:68534) is a nitrile (CHEBI:18379) |
| enzalutamide (CHEBI:68534) is a thiocarbonyl compound (CHEBI:50492) |
| IUPAC Name |
|---|
| 4-{3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-thioxoimidazolidin-1-yl}-2-fluoro-N-methylbenzamide |
| Synonyms | Source |
|---|---|
| MDV 3100 | ChemIDplus |
| MDV3100 | ChemIDplus |
| MDV-3100 | ChemIDplus |
| Brand Name | Source |
|---|---|
| XTANDI | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US2007254933 | Patent |
| WO2011106570 | Patent |
| WO2006124118 | Patent |
| Enzalutamide | Wikipedia |
| LSM-6254 | LINCS |
| 4628 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11718700 | Reaxys |
| CAS:915087-33-1 | ChemIDplus |
| Citations |
|---|