EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29Cl2N5O3.H2O |
| Net Charge | 0 |
| Average Mass | 548.471 |
| Monoisotopic Mass | 547.17531 |
| SMILES | COc1cc(Nc2c(C#N)cnc3cc(OCCCN4CCN(C)CC4)c(OC)cc23)c(Cl)cc1Cl.O |
| InChI | InChI=1S/C26H29Cl2N5O3.H2O/c1-32-6-8-33(9-7-32)5-4-10-36-25-13-21-18(11-24(25)35-3)26(17(15-29)16-30-21)31-22-14-23(34-2)20(28)12-19(22)27;/h11-14,16H,4-10H2,1-3H3,(H,30,31);1H2 |
| InChIKey | BXPOSPOKHGNMEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bosutinib hydrate (CHEBI:68533) has part bosutinib (CHEBI:39112) |
| bosutinib hydrate (CHEBI:68533) has role antineoplastic agent (CHEBI:35610) |
| bosutinib hydrate (CHEBI:68533) has role tyrosine kinase inhibitor (CHEBI:38637) |
| bosutinib hydrate (CHEBI:68533) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| 4-[(2,4-dichloro-5-methoxyphenyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile—water (1/1) |
| Synonyms | Source |
|---|---|
| 4-[(2,4-dichloro-5-methoxyphenyl)amino]-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile monohydrate | ChEBI |
| bosutinib.H2O | ChEBI |
| Bosutinib monohydrate | ChemIDplus |
| SKI-606 monohydrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| BOSULIF | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09728 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15430686 | Reaxys |
| CAS:918639-08-4 | ChemIDplus |