EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H58O6 |
| Net Charge | 0 |
| Average Mass | 574.843 |
| Monoisotopic Mass | 574.42334 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@@]3(C)C(=CC[C@@]4([H])[C@]5([H])CC[C@]([H])([C@H](C)/C=C/[C@@H](CC)C(C)C)[C@@]5(C)CC[C@@]43[H])C2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H58O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h8-10,20-22,24-33,36-39H,7,11-19H2,1-6H3/b9-8+/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1 |
| InChIKey | VWDLOXMZIGUBKM-AUGXRQBFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) has functional parent stigmasterol (CHEBI:28824) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) has parent hydride stigmastane (CHEBI:26773) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) has role metabolite (CHEBI:25212) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) is a monosaccharide derivative (CHEBI:63367) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) is a phytosterols (CHEBI:26125) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) is a steroid saponin (CHEBI:61655) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,22E)-stigmasta-5,22-dien-3-yl β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| stigmasteryl 3-β-D-glucoside | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4302422 | Reaxys |
| Citations |
|---|