EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28824 - stigmasterol
| Formula | C29H48O |
| Net Charge | 0 |
| Average Mass | 412.702 |
| Monoisotopic Mass | 412.37052 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)/C=C/[C@@H](CC)C(C)C |
| InChI | InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3/b9-8+/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | HCXVJBMSMIARIN-PHZDYDNGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eupatorium cannabinum subsp. asiaticum (ncbitaxon:102770) | aerial part (BTO:0001658) | PubMed (21391659) | MeOH extract of shade-dried, pulverized aerial parts,mixture of beta-sitosterol and stigmasterol |
| Pisonia aculeata (ncbitaxon:363212) | |||
| root (BTO:0001188) | PubMed (21542597) | Cold MeOH extract of dried stems and roots, isolated as mixture of beta-setosterol & stigmasterol | |
| stem (BTO:0001300) | PubMed (21542597) | Cold MeOH extract of dried stems and roots, isolated as mixture of beta-setosterol & stigmasterol | |
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia, mixture of beta-sitosterol and stigmasterol |
| Stemona curtisii (ncbitaxon:492018) | root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stigmasterol (CHEBI:28824) has parent hydride stigmastane (CHEBI:26773) |
| stigmasterol (CHEBI:28824) has role plant metabolite (CHEBI:76924) |
| stigmasterol (CHEBI:28824) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| stigmasterol (CHEBI:28824) is a 3β-sterol (CHEBI:35348) |
| stigmasterol (CHEBI:28824) is a phytosterols (CHEBI:26125) |
| stigmasterol (CHEBI:28824) is a stigmastane sterol (CHEBI:131703) |
| Incoming Relation(s) |
| stigmasterol 3-O-acetate (CHEBI:69434) has functional parent stigmasterol (CHEBI:28824) |
| stigmasterol 3-O-β-D-glucoside (CHEBI:68383) has functional parent stigmasterol (CHEBI:28824) |
| delta7-stigmasterol (CHEBI:166889) is a stigmasterol (CHEBI:28824) |
| IUPAC Name |
|---|
| (22E)-stigmasta-5,22-dien-3β-ol |
| Synonyms | Source |
|---|---|
| Stigmasterol | KEGG COMPOUND |
| β-stigmasterol | NIST Chemistry WebBook |
| stigmasta-5,22-dien-3β-ol | NIST Chemistry WebBook |
| 5,22-Cholestadien-24-ethyl-3β-ol | NIST Chemistry WebBook |
| poriferasterol | HMDB |
| (3β,22E)-stigmasta-5,22-dien-3-ol | HMDB |
| UniProt Name | Source |
|---|---|
| stigmasterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05442 | KEGG COMPOUND |
| LMST01040123 | LIPID MAPS |
| HMDB0000937 | HMDB |
| Stigmasterol | Wikipedia |
| C00023774 | KNApSAcK |
| C00003674 | KNApSAcK |
| Citations |
|---|