EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O11 |
| Net Charge | 0 |
| Average Mass | 562.527 |
| Monoisotopic Mass | 562.14751 |
| SMILES | Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C30H26O11/c31-14-3-4-15-24(9-14)40-29(13-2-6-18(33)21(36)8-13)27(39)25(15)26-22(37)11-19(34)16-10-23(38)28(41-30(16)26)12-1-5-17(32)20(35)7-12/h1-9,11,23,25,27-29,31-39H,10H2/t23-,25-,27-,28+,29+/m0/s1 |
| InChIKey | CVPALQKJIJFGCD-WXMJOIKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) has functional parent (+)-catechin (CHEBI:15600) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) has functional parent fisetinidol (CHEBI:5066) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) has role metabolite (CHEBI:25212) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) is a catechin (CHEBI:23053) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'S,4S)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,8'-bichromene-3,3',5',7,7'-pentol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5232282 | Reaxys |
| Citations |
|---|