EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O5 |
| Net Charge | 0 |
| Average Mass | 274.272 |
| Monoisotopic Mass | 274.08412 |
| SMILES | Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O5/c16-10-3-1-8-5-13(19)15(20-14(8)7-10)9-2-4-11(17)12(18)6-9/h1-4,6-7,13,15-19H,5H2/t13-,15+/m0/s1 |
| InChIKey | VFZYLYJWCROVLO-DZGCQCFKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fisetinidol (CHEBI:5066) has parent hydride (2S)-flavan (CHEBI:36103) |
| fisetinidol (CHEBI:5066) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| fisetinidol (CHEBI:5066) has role plant metabolite (CHEBI:76924) |
| fisetinidol (CHEBI:5066) is a catechin (CHEBI:23053) |
| fisetinidol (CHEBI:5066) is a tetrahydroxyflavan (CHEBI:72011) |
| Incoming Relation(s) |
| fisetinidol-(4α,6)-gallocatechin (CHEBI:68335) has functional parent fisetinidol (CHEBI:5066) |
| fisetinidol-(4α,8)-catechin (CHEBI:68334) has functional parent fisetinidol (CHEBI:5066) |
| IUPAC Name |
|---|
| (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,7-diol |
| Synonym | Source |
|---|---|
| 3,7,3',4'-Tetrahydroxyflavan | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008822 | KNApSAcK |
| C09735 | KEGG COMPOUND |
| Fisetinidol | Wikipedia |
| LMPK12020013 | LIPID MAPS |
| LSM-4014 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:91218 | Reaxys |
| CAS:490-49-3 | KEGG COMPOUND |
| Citations |
|---|