EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O11 |
| Net Charge | 0 |
| Average Mass | 466.439 |
| Monoisotopic Mass | 466.14751 |
| SMILES | COc1c(O)cc([C@H]2Oc3cc(O)ccc3C[C@@H]2O)cc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26O11/c1-30-21-13(26)5-10(20-12(25)4-9-2-3-11(24)7-14(9)31-20)6-15(21)32-22-19(29)18(28)17(27)16(8-23)33-22/h2-3,5-7,12,16-20,22-29H,4,8H2,1H3/t12-,16+,17+,18-,19+,20+,22+/m0/s1 |
| InChIKey | SKDCNHZOXYIWDW-YOTCUMCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) has functional parent robinetinidol (CHEBI:68327) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) has role metabolite (CHEBI:25212) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) is a catechin (CHEBI:23053) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) is a flavan glycoside (CHEBI:85938) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) is a methoxyflavan (CHEBI:72585) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) is a monosaccharide derivative (CHEBI:63367) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-[(2R,3S)-3,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl]-3-hydroxy-2-methoxyphenyl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21299008 | Reaxys |
| Citations |
|---|