EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Oc1ccc2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C15H14O6/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8/h1-2,4-6,12,15-20H,3H2/t12-,15+/m0/s1 |
| InChIKey | GMPPKSLKMRADRM-SWLSCSKDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia mearnsii (ncbitaxon:139012) | bark (BTO:0001301) | PubMed (21192716) | Spray-dried aqueous extract of bark |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| robinetinidol (CHEBI:68327) has parent hydride (2S)-flavan (CHEBI:36103) |
| robinetinidol (CHEBI:68327) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| robinetinidol (CHEBI:68327) has role plant metabolite (CHEBI:76924) |
| robinetinidol (CHEBI:68327) is a pentahydroxyflavan (CHEBI:72584) |
| Incoming Relation(s) |
| 4'-O-methylrobinetinidol 3'-O-β-D-glucopyranoside (CHEBI:68328) has functional parent robinetinidol (CHEBI:68327) |
| robinetinidol-(4α,8)-catechin (CHEBI:68333) has functional parent robinetinidol (CHEBI:68327) |
| robinetinidol-(4α,8)-gallocatechin (CHEBI:68332) has functional parent robinetinidol (CHEBI:68327) |
| IUPAC Name |
|---|
| 5-[(2R,3S)-3,7-dihydroxy-3,4-dihydro-2-chromen-2-yl]benzene-1,2,3-triol |
| Manual Xrefs | Databases |
|---|---|
| LMPK12020017 | LIPID MAPS |
| Robinetinidol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:39544 | Reaxys |
| Citations |
|---|