EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO9 |
| Net Charge | 0 |
| Average Mass | 473.478 |
| Monoisotopic Mass | 473.16858 |
| SMILES | [H][C@]12C[C@]34C=C(O)C(=O)[C@@](C)(CCC(=O)Nc5c(O)ccc(C(=O)O)c5O)[C@]3([H])[C@]([H])(C1)O[C@@]2(C)[C@@H]4O |
| InChI | InChI=1S/C24H27NO9/c1-22(6-5-15(28)25-16-12(26)4-3-11(17(16)29)20(31)32)18-14-7-10-8-24(18,9-13(27)19(22)30)21(33)23(10,2)34-14/h3-4,9-10,14,18,21,26-27,29,33H,5-8H2,1-2H3,(H,25,28)(H,31,32)/t10-,14+,18+,21+,22+,23-,24+/m1/s1 |
| InChIKey | YFIXEYMGWRRNJF-MCOUNYMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy platensimycin A1 methyl ester (CHEBI:68270) has functional parent salicylic acid (CHEBI:16914) |
| 6-hydroxy platensimycin A1 methyl ester (CHEBI:68270) has role metabolite (CHEBI:25212) |
| 6-hydroxy platensimycin A1 methyl ester (CHEBI:68270) is a aromatic amine (CHEBI:33860) |
| 6-hydroxy platensimycin A1 methyl ester (CHEBI:68270) is a monohydroxybenzoic acid (CHEBI:25389) |
| Citations |
|---|