EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O4 |
| Net Charge | 0 |
| Average Mass | 304.386 |
| Monoisotopic Mass | 304.16746 |
| SMILES | [H][C@]12C[C@]34C=CC(=O)[C@@](C)(CCC(=O)OC)[C@]3([H])[C@]([H])(C1)O[C@@]2(C)C4 |
| InChI | InChI=1S/C18H24O4/c1-16(6-5-14(20)21-3)13(19)4-7-18-9-11-8-12(15(16)18)22-17(11,2)10-18/h4,7,11-12,15H,5-6,8-10H2,1-3H3/t11-,12+,15+,16-,17+,18+/m1/s1 |
| InChIKey | NUIVTFDVMXNHQW-URWOFZPHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platensic acid methyl ester (CHEBI:68257) has functional parent platensic acid (CHEBI:68256) |
| platensic acid methyl ester (CHEBI:68257) has role metabolite (CHEBI:25212) |
| platensic acid methyl ester (CHEBI:68257) is a cyclic ether (CHEBI:37407) |
| platensic acid methyl ester (CHEBI:68257) is a cyclic ketone (CHEBI:3992) |
| platensic acid methyl ester (CHEBI:68257) is a methyl ester (CHEBI:25248) |
| platensic acid methyl ester (CHEBI:68257) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| methyl 3-[(1S,4aS,6S,7S,9S,9aR)-1,6-dimethyl-2-oxo-1,2,5,6,7,8,9,9a-octahydro-6,9-epoxy-4a,7-methanobenzo[7]annulen-1-yl]propanoate |
| Synonym | Source |
|---|---|
| methyl platensinoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19006908 | Reaxys |
| Citations |
|---|