EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | [H][C@]12C[C@]34C=CC(=O)[C@@](C)(CCC(=O)O)[C@]3([H])[C@]([H])(C1)O[C@@]2(C)C4 |
| InChI | InChI=1S/C17H22O4/c1-15(5-4-13(19)20)12(18)3-6-17-8-10-7-11(14(15)17)21-16(10,2)9-17/h3,6,10-11,14H,4-5,7-9H2,1-2H3,(H,19,20)/t10-,11+,14+,15-,16+,17+/m1/s1 |
| InChIKey | RQCNJFMDDXEKEP-ZMKNGNPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platensic acid (CHEBI:68256) has role metabolite (CHEBI:25212) |
| platensic acid (CHEBI:68256) is a cyclic ether (CHEBI:37407) |
| platensic acid (CHEBI:68256) is a cyclic ketone (CHEBI:3992) |
| platensic acid (CHEBI:68256) is a monocarboxylic acid (CHEBI:25384) |
| platensic acid (CHEBI:68256) is a polycyclic cage (CHEBI:33640) |
| Incoming Relation(s) |
| 14-hydroxyplatensic acid (CHEBI:68258) has functional parent platensic acid (CHEBI:68256) |
| platensic acid methyl ester (CHEBI:68257) has functional parent platensic acid (CHEBI:68256) |
| IUPAC Name |
|---|
| 3-[(1S,4aS,6S,7S,9S,9aR)-1,6-dimethyl-2-oxo-1,2,5,6,7,8,9,9a-octahydro-6,9-epoxy-4a,7-methanobenzo[7]annulen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19006909 | Reaxys |
| Citations |
|---|