EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N4 |
| Net Charge | 0 |
| Average Mass | 140.190 |
| Monoisotopic Mass | 140.10620 |
| SMILES | C1N2CN3CN1CN(C2)C3 |
| InChI | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 |
| InChIKey | VKYKSIONXSXAKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexamethylenetetramine (CHEBI:6824) has role antibacterial drug (CHEBI:36047) |
| hexamethylenetetramine (CHEBI:6824) is a polyazaalkane (CHEBI:39474) |
| hexamethylenetetramine (CHEBI:6824) is a polycyclic cage (CHEBI:33640) |
| hexamethylenetetramine (CHEBI:6824) is a tetramine (CHEBI:39166) |
| Incoming Relation(s) |
| quaternium-15 (CHEBI:59607) has functional parent hexamethylenetetramine (CHEBI:6824) |
| IUPAC Name |
|---|
| 1,3,5,7-tetraazaadamantane |
| INNs | Source |
|---|---|
| methenamine | ChemIDplus |
| methenaminum | ChemIDplus |
| metenamina | ChemIDplus |
| méthénamine | ChEBI |
| Synonyms | Source |
|---|---|
| 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane | IUPAC |
| hexamethylenetetramine | NIST Chemistry WebBook |
| hexamethylenamine | ChemIDplus |
| hexamethylene tetramine | ChemIDplus |
| HMT | NIST Chemistry WebBook |
| HMTA | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Urotropin | ChemIDplus |
| Uritone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D00393 | KEGG DRUG |
| US2762799 | Patent |
| US2762800 | Patent |
| Methenamine | Wikipedia |
| HMDB0029598 | HMDB |
| LSM-5440 | LINCS |
| 3344 | DrugCentral |
| Citations |
|---|