EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59607 - quaternium-15
| Formula | C9H16ClN4.Cl |
| Net Charge | 0 |
| Average Mass | 251.161 |
| Monoisotopic Mass | 250.07520 |
| SMILES | [Cl-].[H]C(Cl)=C([H])C[N+]12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1 |
| InChIKey | UKHVLWKBNNSRRR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quaternium-15 (CHEBI:59607) has functional parent hexamethylenetetramine (CHEBI:6824) |
| quaternium-15 (CHEBI:59607) has role allergen (CHEBI:50904) |
| quaternium-15 (CHEBI:59607) has role antibacterial agent (CHEBI:33282) |
| quaternium-15 (CHEBI:59607) has role disinfectant (CHEBI:48219) |
| quaternium-15 (CHEBI:59607) has role hapten (CHEBI:59174) |
| quaternium-15 (CHEBI:59607) is a organochlorine compound (CHEBI:36683) |
| quaternium-15 (CHEBI:59607) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 1-[3-chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decanium chloride |
| Synonyms | Source |
|---|---|
| 1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane chloride | ChemIDplus |
| 1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride | ChemIDplus |
| CTAC | ChEBI |
| Hexamethylenetetramine chloroallyl chloride | ChemIDplus |
| Methenamine 3-chloroallylochloride | ChemIDplus |
| N-(3-Chloroallyl)hexaminium chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9300843 | Beilstein |
| CAS:4080-31-3 | ChemIDplus |
| Citations |
|---|