EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59607 - quaternium-15
| Formula | C9H16ClN4.Cl |
| Net Charge | 0 |
| Average Mass | 251.161 |
| Monoisotopic Mass | 250.07520 |
| SMILES | [Cl-].[H]C(Cl)=C([H])C[N+]12CN3CN(CN(C3)C1)C2 |
| InChI | InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1 |
| InChIKey | UKHVLWKBNNSRRR-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quaternium-15 (CHEBI:59607) has functional parent hexamethylenetetramine (CHEBI:6824) |
| quaternium-15 (CHEBI:59607) has role allergen (CHEBI:50904) |
| quaternium-15 (CHEBI:59607) has role antibacterial agent (CHEBI:33282) |
| quaternium-15 (CHEBI:59607) has role disinfectant (CHEBI:48219) |
| quaternium-15 (CHEBI:59607) has role hapten (CHEBI:59174) |
| quaternium-15 (CHEBI:59607) is a organochlorine compound (CHEBI:36683) |
| quaternium-15 (CHEBI:59607) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 1-[3-chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decanium chloride |
| Synonyms | Source |
|---|---|
| 1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane chloride | ChemIDplus |
| 1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride | ChemIDplus |
| CTAC | ChEBI |
| Hexamethylenetetramine chloroallyl chloride | ChemIDplus |
| Methenamine 3-chloroallylochloride | ChemIDplus |
| N-(3-Chloroallyl)hexaminium chloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9300843 | Beilstein |
| CAS:4080-31-3 | ChemIDplus |
| Citations |
|---|