EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N3S |
| Net Charge | 0 |
| Average Mass | 261.394 |
| Monoisotopic Mass | 261.12997 |
| SMILES | CN(C)CCN(Cc1cccs1)c1ccccn1 |
| InChI | InChI=1S/C14H19N3S/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | HNJJXZKZRAWDPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methapyrilene (CHEBI:6820) has role anti-allergic agent (CHEBI:50857) |
| methapyrilene (CHEBI:6820) has role carcinogenic agent (CHEBI:50903) |
| methapyrilene (CHEBI:6820) has role H1-receptor antagonist (CHEBI:37955) |
| methapyrilene (CHEBI:6820) has role sedative (CHEBI:35717) |
| methapyrilene (CHEBI:6820) is a ethylenediamine derivative (CHEBI:31577) |
| Incoming Relation(s) |
| methapyrilene hydrochloride (CHEBI:38213) has functional parent methapyrilene (CHEBI:6820) |
| IUPAC Name |
|---|
| N,N-dimethyl-N'-pyridin-2-yl-N'-[(thiophen-2-yl)methyl]ethane-1,2-diamine |
| Synonyms | Source |
|---|---|
| 2-[[2-(dimethylamino)ethyl]-2-thenylamino]pyridine | NIST Chemistry WebBook |
| N,N-dimethyl-N'-pyrid-2-yl-N'-2-thenylethylenediamine | ChemIDplus |
| N,N-dimethyl-N'-pyridin-2-yl-N'-(2-thienylmethyl)ethane-1,2-diamine | IUPAC |
| N-(α-pyridyl)-N-(α-thenyl)-N',N'-dimethylethylenediamine | NIST Chemistry WebBook |
| Histadyl | NIST Chemistry WebBook |
| Lullamin | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Histadyl | DrugBank |
| Lullamin | DrugBank |
| Paradormalene | DrugBank |
| Pyrathyn | DrugBank |
| Pyrinistab | DrugBank |
| Pyrinistol | DrugBank |
| Citations |
|---|