EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38213 - methapyrilene hydrochloride
| Formula | C14H19N3S.HCl |
| Net Charge | 0 |
| Average Mass | 297.855 |
| Monoisotopic Mass | 297.10665 |
| SMILES | CN(C)CCN(Cc1cccs1)c1ccccn1.Cl |
| InChI | InChI=1S/C14H19N3S.ClH/c1-16(2)9-10-17(12-13-6-5-11-18-13)14-7-3-4-8-15-14;/h3-8,11H,9-10,12H2,1-2H3;1H |
| InChIKey | BONORRGKLJBGRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methapyrilene hydrochloride (CHEBI:38213) has functional parent methapyrilene (CHEBI:6820) |
| methapyrilene hydrochloride (CHEBI:38213) has role anti-allergic agent (CHEBI:50857) |
| methapyrilene hydrochloride (CHEBI:38213) has role carcinogenic agent (CHEBI:50903) |
| methapyrilene hydrochloride (CHEBI:38213) has role H1-receptor antagonist (CHEBI:37955) |
| methapyrilene hydrochloride (CHEBI:38213) has role sedative (CHEBI:35717) |
| methapyrilene hydrochloride (CHEBI:38213) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N-dimethyl-N'-pyridin-2-yl-N'-[(thiophen-2-yl)methyl]ethane-1,2-diamine hydrochloride |
| Synonyms | Source |
|---|---|
| Thenylpyramine hydrochloride | ChemIDplus |
| 2-((2-(Dimethylamino)ethyl)-2-thenylamino)pyridine monohydrochloride | ChemIDplus |
| Thenylene hydrochloride | ChemIDplus |
| Methoxylene | ChemIDplus |
| methypyrilene hydrochloride | ChEBI |
| Citations |
|---|