EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26N4O2 |
| Net Charge | 0 |
| Average Mass | 498.586 |
| Monoisotopic Mass | 498.20558 |
| SMILES | Cc1nc2c(n1)-c1ccccc1N(C(=O)c1ccc(NC(=O)c3ccccc3-c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C32H26N4O2/c1-21-33-28-19-20-36(29-14-8-7-13-27(29)30(28)34-21)32(38)23-15-17-24(18-16-23)35-31(37)26-12-6-5-11-25(26)22-9-3-2-4-10-22/h2-18H,19-20H2,1H3,(H,33,34)(H,35,37) |
| InChIKey | IKENVDNFQMCRTR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | vasopressin receptor antagonist Any drug which blocks vasopressin receptors. |
| Applications: | vasopressin receptor antagonist Any drug which blocks vasopressin receptors. aquaretic A class of diuretics which promote aquaresis (the excretion of water without electrolyte loss). neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. hepatoprotective agent Any compound that is able to prevent damage to the liver. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conivaptan (CHEBI:681850) has role aquaretic (CHEBI:194423) |
| conivaptan (CHEBI:681850) has role cardiovascular drug (CHEBI:35554) |
| conivaptan (CHEBI:681850) has role hepatoprotective agent (CHEBI:62868) |
| conivaptan (CHEBI:681850) has role neuroprotective agent (CHEBI:63726) |
| conivaptan (CHEBI:681850) has role vasopressin receptor antagonist (CHEBI:59680) |
| conivaptan (CHEBI:681850) is a benzazepine (CHEBI:35676) |
| Incoming Relation(s) |
| conivaptan hydrochloride (CHEBI:31430) has part conivaptan (CHEBI:681850) |
| IUPAC Name |
|---|
| N-{4-[(2-methyl-4,5-dihydroimidazo[4,5-d][1]benzazepin-6(1H)-yl)carbonyl]phenyl}biphenyl-2-carboxamide |
| INN | Source |
|---|---|
| conivaptan | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4'-((4,5-dihydro-2-methylimidazo(4,5-d)(1)benzazepin-6(1H)-yl)carbonyl)-2-biphenylcarboxanilide | ChemIDplus |
| Conivaptan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 732 | DrugCentral |
| Conivaptan | Wikipedia |
| D07748 | KEGG DRUG |
| DB00872 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8658375 | Beilstein |
| CAS:210101-16-9 | ChemIDplus |
| CAS:210101-16-9 | KEGG DRUG |
| Citations |
|---|