EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H26N4O2.HCl |
| Net Charge | 0 |
| Average Mass | 535.047 |
| Monoisotopic Mass | 534.18225 |
| SMILES | Cc1nc2c(n1)-c1ccccc1N(C(=O)c1ccc(NC(=O)c3ccccc3-c3ccccc3)cc1)CC2.Cl |
| InChI | InChI=1S/C32H26N4O2.ClH/c1-21-33-28-19-20-36(29-14-8-7-13-27(29)30(28)34-21)32(38)23-15-17-24(18-16-23)35-31(37)26-12-6-5-11-25(26)22-9-3-2-4-10-22;/h2-18H,19-20H2,1H3,(H,33,34)(H,35,37);1H |
| InChIKey | BTYHAFSDANBVMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | vasopressin receptor antagonist Any drug which blocks vasopressin receptors. |
| Applications: | aquaretic A class of diuretics which promote aquaresis (the excretion of water without electrolyte loss). vasopressin receptor antagonist Any drug which blocks vasopressin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| conivaptan hydrochloride (CHEBI:31430) has part conivaptan (CHEBI:681850) |
| conivaptan hydrochloride (CHEBI:31430) has role aquaretic (CHEBI:194423) |
| conivaptan hydrochloride (CHEBI:31430) has role vasopressin receptor antagonist (CHEBI:59680) |
| conivaptan hydrochloride (CHEBI:31430) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-{4-[(2-methyl-4,5-dihydroimidazo[4,5-d][1]benzazepin-6(1H)-yl)carbonyl]phenyl}biphenyl-2-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| 4'-((4,5-dihydro-2-methylimidazo(4,5-d)(1)benzazepin-6(1H)-yl)carbonyl)-2-biphenylcarboxanilide monohydrochloride | ChemIDplus |
| conivaptan HCl | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8667691 | Beilstein |
| CAS:168626-94-6 | KEGG DRUG |
| CAS:168626-94-6 | ChemIDplus |