EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=C1O/C(=C\c2ccc(O)c(O)c2)c2cccc(O)c21 |
| InChI | InChI=1S/C15H10O5/c16-10-5-4-8(6-12(10)18)7-13-9-2-1-3-11(17)14(9)15(19)20-13/h1-7,16-18H/b13-7- |
| InChIKey | CFXQRFYFWXTZOJ-QPEQYQDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thunberginol F (CHEBI:68139) has role metabolite (CHEBI:25212) |
| thunberginol F (CHEBI:68139) has role plant metabolite (CHEBI:76924) |
| thunberginol F (CHEBI:68139) is a catechols (CHEBI:33566) |
| thunberginol F (CHEBI:68139) is a isobenzofuranone (CHEBI:55372) |
| thunberginol F (CHEBI:68139) is a γ-lactone (CHEBI:37581) |
| Incoming Relation(s) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) has functional parent thunberginol F (CHEBI:68139) |
| IUPAC Name |
|---|
| (3Z)-3-(3,4-dihydroxybenzylidene)-7-hydroxy-2-benzofuran-1(3H)-one |
| Synonym | Source |
|---|---|
| (Z)-3-((3,4-dihydroxyphenyl)methylene)-7-hydroxy-isobenzofuran-1(3H)-one | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6147567 | Reaxys |
| CAS:147666-82-8 | ChemIDplus |
| Citations |
|---|