EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | O=C1O/C(=C\c2ccc(O)c(O)c2)c2cccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C21H20O10/c22-8-15-17(25)18(26)19(27)21(31-15)30-13-3-1-2-10-14(29-20(28)16(10)13)7-9-4-5-11(23)12(24)6-9/h1-7,15,17-19,21-27H,8H2/b14-7-/t15-,17-,18+,19-,21-/m1/s1 |
| InChIKey | QJVBIFNWYBLVDD-APMKNHDFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scorzonera judaica (ncbitaxon:895824-1) | tuberous root (BTO:0001309) | PubMed (21650157) | Dried powdered roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) has functional parent thunberginol F (CHEBI:68139) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) has role plant metabolite (CHEBI:76924) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) is a catechols (CHEBI:33566) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) is a isobenzofuranone (CHEBI:55372) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) is a monosaccharide derivative (CHEBI:63367) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) is a β-D-glucoside (CHEBI:22798) |
| thunberginol F 7-O-β-D-glucopyranoside (CHEBI:68125) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1Z)-1-(3,4-dihydroxybenzylidene)-3-oxo-1,3-dihydro-2-benzofuran-4-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21646962 | Reaxys |
| Citations |
|---|