EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(CO)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22-,23+,24-,27-,28+,29+,30+/m0/s1 |
| InChIKey | PSZDOEIIIJFCFE-OSQDELBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhododendron (ncbitaxon:4346) | - | PubMed (21443171) | |
| Rhododendron ferrugineum (ncbitaxon:49622) | leaf (BTO:0000713) | PubMed (21443171) | MeOH extract of CHCl3 soluble fraction of air-dried,powdered leaves,uvaol & erythrodiol mixture |
| Olea europaea (ncbitaxon:4146) | fruit (BTO:0000486) | PubMed (18384095) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erythrodiol (CHEBI:67939) has functional parent β-amyrin (CHEBI:10352) |
| erythrodiol (CHEBI:67939) has role plant metabolite (CHEBI:76924) |
| erythrodiol (CHEBI:67939) is a diol (CHEBI:23824) |
| erythrodiol (CHEBI:67939) is a pentacyclic triterpenoid (CHEBI:25872) |
| erythrodiol (CHEBI:67939) is a primary alcohol (CHEBI:15734) |
| erythrodiol (CHEBI:67939) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| oleanolic aldehyde (CHEBI:82827) has functional parent erythrodiol (CHEBI:67939) |
| IUPAC Name |
|---|
| olean-12-ene-3β,28-diol |
| Synonyms | Source |
|---|---|
| (3β)-olean-12-ene-3,28-diol | ChemIDplus |
| 3β-erythrodiol | MetaCyc |
| 3β,28-dihydroxy-ole-12-ene | ChEBI |
| oleanolic alcohol | ChEBI |
| UniProt Name | Source |
|---|---|
| erythrodiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14499 | MetaCyc |
| HMDB0002360 | HMDB |
| C00019065 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2340203 | Reaxys |
| CAS:545-48-2 | ChemIDplus |
| Citations |
|---|