EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-24,31H,10-19H2,1-8H3/t21-,22-,23+,24-,27+,28-,29+,30+/m0/s1 |
| InChIKey | JFSHUTJDVKUMTJ-QHPUVITPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia boonei (ncbitaxon:84857) | bark (BTO:0001301) | PubMed (25026352) | From stem bark |
| Erythrina caffra (ncbitaxon:3842) | bark (BTO:0001301) | PubMed (25115087) | From stem bark |
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (6875511) | Frow wild-type cultures |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-amyrin (CHEBI:10352) has parent hydride oleanane (CHEBI:36481) |
| β-amyrin (CHEBI:10352) has role Aspergillus metabolite (CHEBI:76956) |
| β-amyrin (CHEBI:10352) has role plant metabolite (CHEBI:76924) |
| β-amyrin (CHEBI:10352) is a pentacyclic triterpenoid (CHEBI:25872) |
| β-amyrin (CHEBI:10352) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 11-oxo-β-amyrin (CHEBI:63184) has functional parent β-amyrin (CHEBI:10352) |
| 11α-hydroxy-β-amyrin (CHEBI:63177) has functional parent β-amyrin (CHEBI:10352) |
| 16α-hydroxy-β-amyrin (CHEBI:140655) has functional parent β-amyrin (CHEBI:10352) |
| 24-hydroxy-β-amyrin (CHEBI:62459) has functional parent β-amyrin (CHEBI:10352) |
| 30-hydroxy-11-oxo-β-amyrin (CHEBI:71576) has functional parent β-amyrin (CHEBI:10352) |
| erythrodiol (CHEBI:67939) has functional parent β-amyrin (CHEBI:10352) |
| glycyrrhetaldehyde (CHEBI:71577) has functional parent β-amyrin (CHEBI:10352) |
| IUPAC Name |
|---|
| olean-12-en-3β-ol |
| Synonyms | Source |
|---|---|
| beta-Amyrin | KEGG COMPOUND |
| beta-Amyrenol | KEGG COMPOUND |
| (3β)-olean-12-en-3-ol | IUPAC |
| 3β-hydroxyolean-12-ene | ChEBI |
| amyrin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| β-amyrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C08616 | KEGG COMPOUND |
| CPD-6948 | MetaCyc |
| C00003738 | KNApSAcK |
| LMPR0106150015 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2063468 | Reaxys |
| CAS:559-70-6 | KEGG COMPOUND |
| CAS:559-70-6 | ChemIDplus |
| Citations |
|---|