EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O12 |
| Net Charge | 0 |
| Average Mass | 476.390 |
| Monoisotopic Mass | 476.09548 |
| SMILES | O=c1c2c(oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c13)-c1ccc(O)c(O)c1CO2 |
| InChI | InChI=1S/C22H20O12/c23-5-13-16(27)18(29)19(30)22(34-13)32-7-3-11(25)14-12(4-7)33-20-8-1-2-10(24)15(26)9(8)6-31-21(20)17(14)28/h1-4,13,16,18-19,22-27,29-30H,5-6H2/t13-,16-,18+,19-,22-/m1/s1 |
| InChIKey | ZBYBUYZJKQWRDO-FSFQXNNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has functional parent ophioglonin (CHEBI:66823) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has role metabolite (CHEBI:25212) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has role plant metabolite (CHEBI:76924) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a homoflavonoid glycoside (CHEBI:76404) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a hydroxy homoflavonoid (CHEBI:76405) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a monosaccharide derivative (CHEBI:63367) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,4,8-trihydroxy-7-oxo-5,7-dihydroisochromeno[4,3-b]chromen-10-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769001 | Reaxys |
| Citations |
|---|