EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20O12 |
| Net Charge | 0 |
| Average Mass | 476.390 |
| Monoisotopic Mass | 476.09548 |
| SMILES | O=c1c2c(oc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)c13)-c1ccc(O)c(O)c1CO2 |
| InChI | InChI=1S/C22H20O12/c23-5-13-16(27)18(29)19(30)22(34-13)32-7-3-11(25)14-12(4-7)33-20-8-1-2-10(24)15(26)9(8)6-31-21(20)17(14)28/h1-4,13,16,18-19,22-27,29-30H,5-6H2/t13-,16-,18+,19-,22-/m1/s1 |
| InChIKey | ZBYBUYZJKQWRDO-FSFQXNNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has functional parent ophioglonin (CHEBI:66823) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has role metabolite (CHEBI:25212) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has role plant metabolite (CHEBI:76924) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a homoflavonoid glycoside (CHEBI:76404) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a hydroxy homoflavonoid (CHEBI:76405) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a monosaccharide derivative (CHEBI:63367) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3,4,8-trihydroxy-7-oxo-5,7-dihydroisochromeno[4,3-b]chromen-10-yl β-D-glucopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769001 | Reaxys |
| Citations |
|---|