EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O7 |
| Net Charge | 0 |
| Average Mass | 314.249 |
| Monoisotopic Mass | 314.04265 |
| SMILES | O=c1c2c(oc3cc(O)cc(O)c13)-c1ccc(O)c(O)c1CO2 |
| InChI | InChI=1S/C16H10O7/c17-6-3-10(19)12-11(4-6)23-15-7-1-2-9(18)13(20)8(7)5-22-16(15)14(12)21/h1-4,17-20H,5H2 |
| InChIKey | XUFSGVREMRKLBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophioglossum petiolatum (ncbitaxon:37426) | whole plant (BTO:0001461) | PubMed (15787440) | |
| Ophioglossum pedunculosum (ncbitaxon:60874) | whole plant (BTO:0001461) | PubMed (21401115) | 75% EtOH extract of dried whole plant |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophioglonin (CHEBI:66823) has role anti-HBV agent (CHEBI:64951) |
| ophioglonin (CHEBI:66823) has role plant metabolite (CHEBI:76924) |
| ophioglonin (CHEBI:66823) is a hydroxy homoflavonoid (CHEBI:76405) |
| ophioglonin (CHEBI:66823) is a organic heterotetracyclic compound (CHEBI:38163) |
| ophioglonin (CHEBI:66823) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| ophioglonin 7-O-β-D-glucopyranoside (CHEBI:67936) has functional parent ophioglonin (CHEBI:66823) |
| IUPAC Name |
|---|
| 3,4,8,10-tetrahydroxyisochromeno[4,3-b]chromen-7(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15768999 | Reaxys |
| Citations |
|---|