EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H58O11 |
| Net Charge | 0 |
| Average Mass | 666.849 |
| Monoisotopic Mass | 666.39791 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C36H58O11/c1-18-9-12-36(30(44)47-29-26(42)25(41)24(40)21(16-37)46-29)14-13-33(4)19(27(36)35(18,6)45)7-8-23-31(2)15-20(39)28(43)32(3,17-38)22(31)10-11-34(23,33)5/h7,18,20-29,37-43,45H,8-17H2,1-6H3/t18-,20-,21-,22-,23-,24-,25+,26-,27-,28+,29+,31+,32+,33-,34-,35-,36+/m1/s1 |
| InChIKey | WKKBYJLXSKPKSC-JVJIQXRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) has functional parent 19α-hydroxyasiatic acid (CHEBI:67915) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) has parent hydride ursane (CHEBI:35711) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) has role plant metabolite (CHEBI:76924) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) is a monosaccharide derivative (CHEBI:63367) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) is a pentacyclic triterpenoid (CHEBI:25872) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) is a tetrol (CHEBI:33573) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) is a triterpenoid saponin (CHEBI:61778) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-[(2α,3β)-2,3,19,23-tetrahydroxy-28-oxours-12-en-28-yl]-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| nigaichigoside F1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5370152 | Reaxys |
| Citations |
|---|