EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O6 |
| Net Charge | 0 |
| Average Mass | 504.708 |
| Monoisotopic Mass | 504.34509 |
| SMILES | [H][C@]12CC=C3[C@@]4([H])[C@](C(=O)O)(CC[C@@H](C)[C@@]4(C)O)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)C[C@@H](O)[C@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H48O6/c1-17-9-12-30(24(34)35)14-13-27(4)18(22(30)29(17,6)36)7-8-21-25(2)15-19(32)23(33)26(3,16-31)20(25)10-11-28(21,27)5/h7,17,19-23,31-33,36H,8-16H2,1-6H3,(H,34,35)/t17-,19-,20-,21-,22-,23+,25+,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | YCOKATFNRPZIIU-NIZSJLHKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19α-hydroxyasiatic acid (CHEBI:67915) has functional parent asiatic acid (CHEBI:2873) |
| 19α-hydroxyasiatic acid (CHEBI:67915) has parent hydride ursane (CHEBI:35711) |
| 19α-hydroxyasiatic acid (CHEBI:67915) has role anti-inflammatory agent (CHEBI:67079) |
| 19α-hydroxyasiatic acid (CHEBI:67915) has role plant metabolite (CHEBI:76924) |
| 19α-hydroxyasiatic acid (CHEBI:67915) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 19α-hydroxyasiatic acid (CHEBI:67915) is a pentacyclic triterpenoid (CHEBI:25872) |
| 19α-hydroxyasiatic acid (CHEBI:67915) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| 19α-hydroxyasiatic acid-28-O-β-D-glucopyrannoside (CHEBI:67917) has functional parent 19α-hydroxyasiatic acid (CHEBI:67915) |
| IUPAC Name |
|---|
| (2α,3β)-2,3,19,23-tetrahydroxyurs-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| 23-hydroxytormentic acid | ChEBI |
| meyanthic acid | ChEBI |
| myrianthic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5171303 | Reaxys |
| CAS:89786-84-5 | ChemIDplus |
| Citations |
|---|