EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N4O |
| Net Charge | 0 |
| Average Mass | 202.217 |
| Monoisotopic Mass | 202.08546 |
| SMILES | Cc1nnc(-c2ccccc2)c(=O)n1N |
| InChI | InChI=1S/C10H10N4O/c1-7-12-13-9(10(15)14(7)11)8-5-3-2-4-6-8/h2-6H,11H2,1H3 |
| InChIKey | VHCNQEUWZYOAEV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metamitron (CHEBI:6791) has role environmental contaminant (CHEBI:78298) |
| metamitron (CHEBI:6791) has role herbicide (CHEBI:24527) |
| metamitron (CHEBI:6791) has role xenobiotic (CHEBI:35703) |
| metamitron (CHEBI:6791) is a 1,2,4-triazines (CHEBI:39410) |
| Incoming Relation(s) |
| metamitron-desamino (CHEBI:83447) has functional parent metamitron (CHEBI:6791) |
| IUPAC Name |
|---|
| 4-amino-3-methyl-6-phenyl-1,2,4-triazin-5(4H)-one |
| Synonym | Source |
|---|---|
| Goltix | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 448 | PPDB |
| C10930 | KEGG COMPOUND |
| metamitron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:613129 | Reaxys |
| CAS:41394-05-2 | ChemIDplus |
| CAS:41394-05-2 | KEGG COMPOUND |
| Citations |
|---|