EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O8 |
| Net Charge | 0 |
| Average Mass | 516.631 |
| Monoisotopic Mass | 516.27232 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)C=C(C)[C@H](O)[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(=O)C(C)C)[C@](C)(COC(=O)/C(C)=C\C)[C@]21[H] |
| InChI | InChI=1S/C29H40O8/c1-9-15(4)25(33)36-13-26(8)22-20-21(30)17(6)11-27(34)19(10-16(5)23(27)31)29(20,35)18(7)12-28(22,26)37-24(32)14(2)3/h9-11,14,18-22,30,34-35H,12-13H2,1-8H3/b15-9-/t18-,19-,20+,21+,22-,26-,27-,28+,29+/m1/s1 |
| InChIKey | WFWMFGZANWSYAM-RJTCIUCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia grandicornis (ncbitaxon:334676) | aerial part (BTO:0001658) | PubMed (21319774) | The CHCl3 soluble fraction of methanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rel-16-Angeloyloxy-13alpha-isobutanoyloxy-4beta,9alpha,7beta-trihydroxytiglia-1,5-dien-3-one (CHEBI:67864) has role metabolite (CHEBI:25212) |
| rel-16-Angeloyloxy-13alpha-isobutanoyloxy-4beta,9alpha,7beta-trihydroxytiglia-1,5-dien-3-one (CHEBI:67864) is a phorbol ester (CHEBI:37532) |
| Citations |
|---|