EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@]2([H])O[C@]3(CC[C@@H](C)CO3)[C@@H](C)[C@]12[H] |
| InChI | InChI=1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | WQLVFSAGQJTQCK-VKROHFNGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dioscorea (ncbitaxon:4672) | tuber (BTO:0001400) | PubMed (21391660) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diosgenin (CHEBI:4629) has parent hydride spirostan (CHEBI:26745) |
| diosgenin (CHEBI:4629) has role antineoplastic agent (CHEBI:35610) |
| diosgenin (CHEBI:4629) has role antiviral agent (CHEBI:22587) |
| diosgenin (CHEBI:4629) has role apoptosis inducer (CHEBI:68495) |
| diosgenin (CHEBI:4629) has role metabolite (CHEBI:25212) |
| diosgenin (CHEBI:4629) is a 3β-sterol (CHEBI:35348) |
| diosgenin (CHEBI:4629) is a hexacyclic triterpenoid (CHEBI:70994) |
| diosgenin (CHEBI:4629) is a sapogenin (CHEBI:26606) |
| diosgenin (CHEBI:4629) is a spiroketal (CHEBI:72600) |
| Incoming Relation(s) |
| 26-desglucoprotodioscin (CHEBI:74026) has functional parent diosgenin (CHEBI:4629) |
| dioscin (CHEBI:74023) has functional parent diosgenin (CHEBI:4629) |
| diosgenin 3-O-β-D-glucoside (CHEBI:74020) has functional parent diosgenin (CHEBI:4629) |
| IUPAC Name |
|---|
| (3β,25R)-spirost-5-en-3-ol |
| Synonyms | Source |
|---|---|
| (20R,25R)-spirost-5-en-3β-ol | ChemIDplus |
| (25R)-spirost-5-en-3β-ol | ChemIDplus |
| nitogenin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| diosgenin | UniProt |
| Citations |
|---|