EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2OS2.C6H6O3S |
| Net Charge | 0 |
| Average Mass | 544.764 |
| Monoisotopic Mass | 544.15242 |
| SMILES | CN1CCCCC1CCN1c2ccccc2Sc2ccc(S(C)=O)cc21.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2OS2.C6H6O3S/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23;7-10(8,9)6-4-2-1-3-5-6/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3;1-5H,(H,7,8,9) |
| InChIKey | CRJHBCPQHRVYBS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesoridazine besylate (CHEBI:6781) has part mesoridazine (CHEBI:6780) |
| mesoridazine besylate (CHEBI:6781) has role dopaminergic antagonist (CHEBI:48561) |
| mesoridazine besylate (CHEBI:6781) has role first generation antipsychotic (CHEBI:65190) |
| mesoridazine besylate (CHEBI:6781) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine benzenesulfonate |
| Synonyms | Source |
|---|---|
| (±)-10-(2-(1-methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine monobenzenesulfonate | ChemIDplus |
| 10-(2-(1-methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine monobenzenesulfonate | ChemIDplus |
| mesoridazine benzenesulfonate | ChemIDplus |
| mesoridazine monobenzenesulfonate | ChEBI |
| NC 123 | ChemIDplus |
| thioridazine-2-sulfoxide besylate | ChEBI |
| Brand Names | Source |
|---|---|
| Lidanar | ChEBI |
| Lidanil | ChEBI |
| Serentil | ChEBI |
| Serentil | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4121451 | Reaxys |
| CAS:32672-69-8 | KEGG DRUG |
| CAS:32672-69-8 | ChemIDplus |