EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2OS2 |
| Net Charge | 0 |
| Average Mass | 386.586 |
| Monoisotopic Mass | 386.14866 |
| SMILES | CN1CCCCC1CCN1c2ccccc2Sc2ccc(S(C)=O)cc21 |
| InChI | InChI=1S/C21H26N2OS2/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(26(2)24)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3 |
| InChIKey | SLVMESMUVMCQIY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| Applications: | first generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be more likely than second generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements; such body movements can become permanent even after treatment has ceased. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesoridazine (CHEBI:6780) has role dopaminergic antagonist (CHEBI:48561) |
| mesoridazine (CHEBI:6780) has role first generation antipsychotic (CHEBI:65190) |
| mesoridazine (CHEBI:6780) is a phenothiazines (CHEBI:38093) |
| mesoridazine (CHEBI:6780) is a sulfoxide (CHEBI:22063) |
| mesoridazine (CHEBI:6780) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| mesoridazine besylate (CHEBI:6781) has part mesoridazine (CHEBI:6780) |
| IUPAC Name |
|---|
| 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-(methylsulfinyl)-10H-phenothiazine |
| INNs | Source |
|---|---|
| mesoridazina | ChemIDplus |
| mesoridazine | ChemIDplus |
| mesoridazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 10-(2-(1-Methyl-2-piperidyl)ethyl)-2-methylsulfinyl phenothiazine | ChemIDplus |
| 10-(2(1-Methyl-2-piperidyl)ethyl)-2-(methylsulfinyl)phenothiazine | ChemIDplus |
| 2-Methanesulfinyl-10-[2-(1-methyl-piperidin-2-yl)-ethyl]-10H-phenothiazine | ChEMBL |
| Mesoridazine | KEGG COMPOUND |
| NC-123 | ChEMBL |
| NSC-186066 | ChEMBL |
| Citations |
|---|