EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:6775 - mesalamine
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
| InChIKey | KBOPZPXVLCULAV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesalamine (CHEBI:6775) has functional parent salicylic acid (CHEBI:16914) |
| mesalamine (CHEBI:6775) has role anti-HIV agent (CHEBI:64946) |
| mesalamine (CHEBI:6775) has role anti-inflammatory agent (CHEBI:67079) |
| mesalamine (CHEBI:6775) has role antineoplastic agent (CHEBI:35610) |
| mesalamine (CHEBI:6775) has role antispasmodic drug (CHEBI:53784) |
| mesalamine (CHEBI:6775) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| mesalamine (CHEBI:6775) is a amino acid (CHEBI:33709) |
| mesalamine (CHEBI:6775) is a aromatic amine (CHEBI:33860) |
| mesalamine (CHEBI:6775) is a monocarboxylic acid (CHEBI:25384) |
| mesalamine (CHEBI:6775) is a monohydroxybenzoic acid (CHEBI:25389) |
| mesalamine (CHEBI:6775) is a phenols (CHEBI:33853) |
| mesalamine (CHEBI:6775) is conjugate acid of mesalaminate(1−) (CHEBI:20551) |
| Incoming Relation(s) |
| mesalaminate(1−) (CHEBI:20551) is conjugate base of mesalamine (CHEBI:6775) |
| IUPAC Name |
|---|
| 5-amino-2-hydroxybenzoic acid |
| INNs | Source |
|---|---|
| mesalazina | WHO MedNet |
| mesalazine | DrugBank |
| mésalazine | WHO MedNet |
| mesalazinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3-carboxy-4-hydroxyaniline | ChEBI |
| 5-Aminosalicylic acid | ChemIDplus |
| 5-ASA | ChemIDplus |
| Benzoic acid, 5-amino-2-hydroxy- | ChEMBL |
| m-Aminosalicylic acid | ChemIDplus |
| MAX-002 | ChEMBL |
| Brand Names | Source |
|---|---|
| Apriso | ChEMBL |
| Asacol | KEGG DRUG |
| Asacol hd | ChEMBL |
| Asacolitin | DrugBank |
| Canasa | DrugBank |
| Claversal | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1710 | DrugCentral |
| CPD-12711 | MetaCyc |
| D00377 | KEGG DRUG |
| DB00244 | DrugBank |
| HMDB0014389 | HMDB |
| LSM-5427 | LINCS |
| Mesalamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2090421 | Reaxys |
| CAS:89-57-6 | ChemIDplus |
| Citations |
|---|