EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6775 - mesalamine
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) |
| InChIKey | KBOPZPXVLCULAV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mesalamine (CHEBI:6775) has functional parent salicylic acid (CHEBI:16914) |
| mesalamine (CHEBI:6775) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| mesalamine (CHEBI:6775) is a amino acid (CHEBI:33709) |
| mesalamine (CHEBI:6775) is a aromatic amine (CHEBI:33860) |
| mesalamine (CHEBI:6775) is a monocarboxylic acid (CHEBI:25384) |
| mesalamine (CHEBI:6775) is a monohydroxybenzoic acid (CHEBI:25389) |
| mesalamine (CHEBI:6775) is a phenols (CHEBI:33853) |
| mesalamine (CHEBI:6775) is conjugate acid of mesalaminate(1−) (CHEBI:20551) |
| Incoming Relation(s) |
| mesalaminate(1−) (CHEBI:20551) is conjugate base of mesalamine (CHEBI:6775) |
| IUPAC Name |
|---|
| 5-amino-2-hydroxybenzoic acid |
| INNs | Source |
|---|---|
| mesalazine | DrugBank |
| mésalazine | WHO MedNet |
| mesalazinum | WHO MedNet |
| mesalazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mesalazine | KEGG DRUG |
| 5-Aminosalicylic acid | ChemIDplus |
| m-Aminosalicylic acid | ChemIDplus |
| p-Aminosalicylsaeure | ChEBI |
| 5-ASA | ChemIDplus |
| 3-carboxy-4-hydroxyaniline | ChEBI |
| Brand Names | Source |
|---|---|
| Asacol | KEGG DRUG |
| Iialda | KEGG DRUG |
| Pentasa | KEGG DRUG |
| Rowasa | KEGG DRUG |
| Asacolitin | DrugBank |
| Canasa | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00377 | KEGG DRUG |
| DB00244 | DrugBank |
| Mesalamine | Wikipedia |
| HMDB0014389 | HMDB |
| CPD-12711 | MetaCyc |
| LSM-5427 | LINCS |
| 1710 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2090421 | Reaxys |
| CAS:89-57-6 | ChemIDplus |
| Citations |
|---|