EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO8 |
| Net Charge | 0 |
| Average Mass | 466.914 |
| Monoisotopic Mass | 466.13945 |
| SMILES | CC[C@H](C)/C=C/C1=CC2=C(Cl)C(=O)[C@@]3(C)OC(=O)C4=C(C(C)C(C)O)OC(O1)C2(O)C43O |
| InChI | InChI=1S/C23H27ClO8/c1-6-10(2)7-8-13-9-14-16(24)18(26)21(5)23(29)15(19(27)32-21)17(11(3)12(4)25)31-20(30-13)22(14,23)28/h7-12,20,25,28-29H,6H2,1-5H3/b8-7+/t10-,11?,12?,20?,21+,22?,23?/m0/s1 |
| InChIKey | MYEDOZFFLHARPQ-MDJFZDGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| mycelium (BTO:0001436) | PubMed (21548578) | Endophytic fungus in leaves of Viguiera robusta, EtOAc extract of culture broth and mycelium | |
| - | PubMed (21548578) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoviridin I (CHEBI:67621) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoviridin I (CHEBI:67621) is a azaphilone (CHEBI:50941) |
| chaetoviridin I (CHEBI:67621) is a enone (CHEBI:51689) |
| chaetoviridin I (CHEBI:67621) is a organic heterotetracyclic compound (CHEBI:38163) |
| chaetoviridin I (CHEBI:67621) is a organochlorine compound (CHEBI:36683) |
| chaetoviridin I (CHEBI:67621) is a secondary alcohol (CHEBI:35681) |
| chaetoviridin I (CHEBI:67621) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (9aS)-8-chloro-9b,9c-dihydroxy-3-(3-hydroxybutan-2-yl)-9a-methyl-6-[(1E,3S)-3-methylpent-1-en-1-yl]-4a,9a,9b,9c-tetrahydro-2H,9H-furo[4,3,2-de]pyrano[4,3,2-ij]isochromene-2,9-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21577527 | Reaxys |
| Citations |
|---|