EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25ClO5 |
| Net Charge | 0 |
| Average Mass | 416.901 |
| Monoisotopic Mass | 416.13905 |
| SMILES | [H][C@]12C3=COC(/C=C/[C@@H](C)CC)=CC3=C(Cl)C(=O)[C@@]1(C)OC(=O)[C@H]2C(=O)/C(C)=C/C |
| InChI | InChI=1S/C23H25ClO5/c1-6-12(3)8-9-14-10-15-16(11-28-14)18-17(20(25)13(4)7-2)22(27)29-23(18,5)21(26)19(15)24/h7-12,17-18H,6H2,1-5H3/b9-8+,13-7+/t12-,17+,18+,23-/m0/s1 |
| InChIKey | GFTHCZMPYKVNIC-GETGECRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| mycelium (BTO:0001436) | PubMed (21548578) | Endophytic fungus in leaves of Viguiera robusta, EtOAc extract of culture broth and mycelium | |
| - | PubMed (21548578) |
| Roles Classification |
|---|
| Biological Roles: | Chaetomium metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Chaetomium. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chaetoviridin G (CHEBI:67619) has role Chaetomium metabolite (CHEBI:76960) |
| chaetoviridin G (CHEBI:67619) is a azaphilone (CHEBI:50941) |
| chaetoviridin G (CHEBI:67619) is a enone (CHEBI:51689) |
| chaetoviridin G (CHEBI:67619) is a organic heterotricyclic compound (CHEBI:26979) |
| chaetoviridin G (CHEBI:67619) is a organochlorine compound (CHEBI:36683) |
| chaetoviridin G (CHEBI:67619) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (6aS,9R,9aS)-5-chloro-6a-methyl-9-[(2E)-2-methylbut-2-enoyl]-3-[(1E,3S)-3-methylpent-1-en-1-yl]-9,9a-dihydro-6H-furo[2,3-h]isochromene-6,8(6aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21577521 | Reaxys |
| Citations |
|---|