EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO7 |
| Net Charge | 0 |
| Average Mass | 450.915 |
| Monoisotopic Mass | 450.14453 |
| SMILES | [H][C@]12C3=COC(/C=C/[C@@H](C)[C@@H](C)O)=CC3=C(Cl)C(=O)[C@@]1(C)OC(=O)[C@H]2C(=O)[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C23H27ClO7/c1-10(12(3)25)6-7-14-8-15-16(9-30-14)18-17(20(27)11(2)13(4)26)22(29)31-23(18,5)21(28)19(15)24/h6-13,17-18,25-26H,1-5H3/b7-6+/t10-,11+,12-,13+,17-,18-,23+/m1/s1 |
| InChIKey | MEPQPODJTXSHEP-HETSEVKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium globosum (ncbitaxon:38033) | |||
| mycelium (BTO:0001436) | PubMed (21548578) | Endophytic fungus in leaves of Viguiera robusta, EtOAc extract of culture broth and mycelium | |
| - | PubMed (21548578) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) has functional parent chaetoviridin C (CHEBI:68743) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a azaphilone (CHEBI:50941) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a enone (CHEBI:51689) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a organic heterotricyclic compound (CHEBI:26979) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a organochlorine compound (CHEBI:36683) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a secondary alcohol (CHEBI:35681) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a β-hydroxy ketone (CHEBI:55380) |
| 12β-hydroxychaetoviridin C (CHEBI:67618) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| rel-(6aS,9R,9aS)-5-chloro-9-[(2S,3S)-3-hydroxy-2-methylbutanoyl]-3-[(1E,3R,4R)-4-hydroxy-3-methylpent-1-en-1-yl]-6a-methyl-9,9a-dihydro-6H-furo[2,3-h]isochromene-6,8(6aH)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21577529 | Reaxys |
| Citations |
|---|