EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C(=C)C)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-17(2)18-10-13-30(25(33)34)15-14-28(6)19(23(18)30)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h18-24,31-32H,1,8-16H2,2-7H3,(H,33,34)/t18-,19+,20+,21-,22+,23+,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | PFCVZKFJHRCLCC-PGOIBATFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Breynia fruticosa (ncbitaxon:296042) | root (BTO:0001188) | PubMed (21428418) | 90% Methanolic extract of air-dried, crushed roots. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α,3β-dihydroxy-20(29)-lupen-28-oic acid (CHEBI:67600) has functional parent betulinic acid (CHEBI:3087) |
| 2α,3β-dihydroxy-20(29)-lupen-28-oic acid (CHEBI:67600) has parent hydride lupane (CHEBI:36485) |
| 2α,3β-dihydroxy-20(29)-lupen-28-oic acid (CHEBI:67600) has role plant metabolite (CHEBI:76924) |
| 2α,3β-dihydroxy-20(29)-lupen-28-oic acid (CHEBI:67600) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 2α,3β-dihydroxy-20(29)-lupen-28-oic acid (CHEBI:67600) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 2α,3β-dihydroxylup-20(29)-en-28-oic acid |
| Synonym | Source |
|---|---|
| 2α-hydroxybetulinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16912 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5648545 | Reaxys |
| CAS:19533-92-7 | KEGG COMPOUND |
| CAS:19533-92-7 | ChemIDplus |
| Citations |
|---|