EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O.HCl |
| Net Charge | 0 |
| Average Mass | 282.815 |
| Monoisotopic Mass | 282.14989 |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCCN1C.Cl |
| InChI | InChI=1S/C15H22N2O.ClH/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3;/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18);1H |
| InChIKey | RETIMRUQNCDCQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepivacaine hydrochloride (CHEBI:6760) has functional parent mepivacaine (CHEBI:6759) |
| mepivacaine hydrochloride (CHEBI:6760) has role analgesic (CHEBI:35480) |
| mepivacaine hydrochloride (CHEBI:6760) has role local anaesthetic (CHEBI:36333) |
| mepivacaine hydrochloride (CHEBI:6760) is a hydrochloride (CHEBI:36807) |
| mepivacaine hydrochloride (CHEBI:6760) is a piperidinecarboxamide (CHEBI:48592) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide hydrochloride (1:1) |
| Synonyms | Source |
|---|---|
| 1-methyl-2',6'-pipecoloxylidide hydrochloride | ChemIDplus |
| (±)-1-methyl-2',6'-pipecoloxylidide monohydrochloride | ChemIDplus |
| 1-methyl-2',6'-pipecoloxylidide monohydrochloride | ChemIDplus |
| (1-methyl-DL-piperidine-2-carboxylic acid)-2,6-dimethylanilide hydrochloride | ChemIDplus |
| mepivacaine HCl | ChemIDplus |
| Mepivacaine monohydrochloride | ChEMBL |
| Brand Names | Source |
|---|---|
| Arestocaine hydrochloride | ChEMBL |
| Isocaine hydrochloride | ChEMBL |
| Polocaine | ChEMBL |
| Polocaine-mpf | ChEMBL |
| Scandicaine | ChEMBL |
| Scandonest | ChEMBL |
| Citations |
|---|