EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O.HCl |
| Net Charge | 0 |
| Average Mass | 282.815 |
| Monoisotopic Mass | 282.14989 |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCCN1C.Cl |
| InChI | InChI=1S/C15H22N2O.ClH/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3;/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18);1H |
| InChIKey | RETIMRUQNCDCQB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepivacaine hydrochloride (CHEBI:6760) has functional parent mepivacaine (CHEBI:6759) |
| mepivacaine hydrochloride (CHEBI:6760) has role analgesic (CHEBI:35480) |
| mepivacaine hydrochloride (CHEBI:6760) has role local anaesthetic (CHEBI:36333) |
| mepivacaine hydrochloride (CHEBI:6760) is a hydrochloride (CHEBI:36807) |
| mepivacaine hydrochloride (CHEBI:6760) is a piperidinecarboxamide (CHEBI:48592) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide hydrochloride (1:1) |
| Synonyms | Source |
|---|---|
| 1-methyl-2',6'-pipecoloxylidide hydrochloride | ChemIDplus |
| (±)-1-methyl-2',6'-pipecoloxylidide monohydrochloride | ChemIDplus |
| 1-methyl-2',6'-pipecoloxylidide monohydrochloride | ChemIDplus |
| (1-methyl-DL-piperidine-2-carboxylic acid)-2,6-dimethylanilide hydrochloride | ChemIDplus |
| mepivacaine HCl | ChemIDplus |
| Mepivacaine monohydrochloride | ChEMBL |
| Brand Names | Source |
|---|---|
| Arestocaine hydrochloride | ChEMBL |
| Isocaine hydrochloride | ChEMBL |
| Polocaine | ChEMBL |
| Polocaine-mpf | ChEMBL |
| Scandicaine | ChEMBL |
| Scandonest | ChEMBL |
| Citations |
|---|