EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O |
| Net Charge | 0 |
| Average Mass | 246.354 |
| Monoisotopic Mass | 246.17321 |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCCN1C |
| InChI | InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18) |
| InChIKey | INWLQCZOYSRPNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepivacaine (CHEBI:6759) has role analgesic (CHEBI:35480) |
| mepivacaine (CHEBI:6759) has role anti-inflammatory agent (CHEBI:67079) |
| mepivacaine (CHEBI:6759) has role drug allergen (CHEBI:88188) |
| mepivacaine (CHEBI:6759) has role local anaesthetic (CHEBI:36333) |
| mepivacaine (CHEBI:6759) is a piperidinecarboxamide (CHEBI:48592) |
| Incoming Relation(s) |
| mepivacaine hydrochloride (CHEBI:6760) has functional parent mepivacaine (CHEBI:6759) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide |
| INNs | Source |
|---|---|
| mepivacaina | ChemIDplus |
| mepivacaine | ChemIDplus |
| mepivacainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-2',6'-pipecoloxylidide | NIST Chemistry WebBook |
| (+-)-1-Methyl-2',6'-pipecoloxylidide | ChemIDplus |
| 2',6'-pipecoloxylidide, 1-methyl- | ChEMBL |
| APF-135 | ChEMBL |
| Carbocaine | NIST Chemistry WebBook |
| Carboplyin dental | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1700 | DrugCentral |
| C07528 | KEGG COMPOUND |
| D08181 | KEGG DRUG |
| DB00961 | DrugBank |
| HMDB0015096 | HMDB |
| LSM-4306 | LINCS |
| Mepivacaine | Wikipedia |
| US2799679 | Patent |
| Citations |
|---|