EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O |
| Net Charge | 0 |
| Average Mass | 246.354 |
| Monoisotopic Mass | 246.17321 |
| SMILES | Cc1cccc(C)c1NC(=O)C1CCCCN1C |
| InChI | InChI=1S/C15H22N2O/c1-11-7-6-8-12(2)14(11)16-15(18)13-9-4-5-10-17(13)3/h6-8,13H,4-5,9-10H2,1-3H3,(H,16,18) |
| InChIKey | INWLQCZOYSRPNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mepivacaine (CHEBI:6759) has role drug allergen (CHEBI:88188) |
| mepivacaine (CHEBI:6759) has role local anaesthetic (CHEBI:36333) |
| mepivacaine (CHEBI:6759) is a piperidinecarboxamide (CHEBI:48592) |
| Incoming Relation(s) |
| mepivacaine hydrochloride (CHEBI:6760) has functional parent mepivacaine (CHEBI:6759) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)-1-methylpiperidine-2-carboxamide |
| INNs | Source |
|---|---|
| mepivacaina | ChemIDplus |
| mepivacaine | ChemIDplus |
| mepivacainum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-2',6'-pipecoloxylidide | NIST Chemistry WebBook |
| (+-)-1-Methyl-2',6'-pipecoloxylidide | ChemIDplus |
| Carbocaine | NIST Chemistry WebBook |
| DL-Mepivacaine | NIST Chemistry WebBook |
| N-(2,6-Dimethylphenyl)-1-methyl-2-piperidinecarboxamide | NIST Chemistry WebBook |
| N-(2,6-Dimethylphenyl)-1-methylpiperidine-2-carboxamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1700 | DrugCentral |
| C07528 | KEGG COMPOUND |
| D08181 | KEGG DRUG |
| DB00961 | DrugBank |
| HMDB0015096 | HMDB |
| LSM-4306 | LINCS |
| Mepivacaine | Wikipedia |
| US2799679 | Patent |
| Citations |
|---|