EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | COc1c(-c2ccc(O)cc2)cc(OC)c2c1oc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C20H16O6/c1-24-17-8-12(10-3-5-11(21)6-4-10)19(25-2)20-18(17)13-7-14(22)15(23)9-16(13)26-20/h3-9,21-23H,1-2H3 |
| InChIKey | LMJVXQOOTLMXHB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus taichungensis (ncbitaxon:482145) | mycelium (BTO:0001436) | PubMed (21486068) | EtOAc extract of fungal strain was isolated from root soil of Acrostichum aureum (mangrove plant) Strain: ZHN 7-07 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| candidusin A (CHEBI:67539) has role Aspergillus metabolite (CHEBI:76956) |
| candidusin A (CHEBI:67539) is a aromatic ether (CHEBI:35618) |
| candidusin A (CHEBI:67539) is a catechols (CHEBI:33566) |
| candidusin A (CHEBI:67539) is a dibenzofurans (CHEBI:38922) |
| Incoming Relation(s) |
| prenylcandidusin A (CHEBI:67530) has functional parent candidusin A (CHEBI:67539) |
| IUPAC Name |
|---|
| 7-(4-hydroxyphenyl)-6,9-dimethoxydibenzo[b,d]furan-2,3-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6878366 | Reaxys |
| Citations |
|---|